C16H24N4O — CID 110962963
4-acetyl-N'-benzyl-N-ethylpiperazine-1-carboximidamide (PubChem CID 110962963) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-acetyl-N'-benzyl-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-benzyl-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962963 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-acetyl-N'-benzyl-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H24N4O/c1-3-17-16(18-13-15-7-5-4-6-8-15)20-11-9-19(10-12-20)14(2)21/h4-8H,3,9-13H2,1-2H3,(H,17,18) |
| InChIKey | PQTUNYHCEZIBSU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|