C19H32IN5O — CID 110963260
4-acetyl-N'-[[3-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110963260) has the molecular formula C19H32IN5O and a molecular weight of 473.40 g/mol. Its IUPAC name is 4-acetyl-N'-[[3-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N'-[[3-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110963260 |
| Molecular Formula | C19H32IN5O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-acetyl-N'-[[3-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN(C)C)c1)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C19H31N5O.HI/c1-5-20-19(24-11-9-23(10-12-24)16(2)25)21-14-17-7-6-8-18(13-17)15-22(3)4;/h6-8,13H,5,9-12,14-15H2,1-4H3,(H,20,21);1H |
| InChIKey | XRDQQISSSINYRY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|