C21H34N6O2 — CID 110962775
3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 110962775) has the molecular formula C21H34N6O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 110962775 |
| Molecular Formula | C21H34N6O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C21H34N6O2/c1-5-22-21(27-13-11-26(12-14-27)17(2)28)24-16-18-7-6-8-19(15-18)20(29)23-9-10-25(3)4/h6-8,15H,5,9-14,16H2,1-4H3,(H,22,24)(H,23,29) |
| InChIKey | WTRZXCYYCUDNJE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|