C24H31IN4O3 — CID 110963664
benzyl 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 110963664) has the molecular formula C24H31IN4O3 and a molecular weight of 550.44 g/mol. Its IUPAC name is benzyl 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | benzyl 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 110963664 |
| Molecular Formula | C24H31IN4O3 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | benzyl 3-[[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)OCc2ccccc2)c1)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C24H30N4O3.HI/c1-3-25-24(28-14-12-27(13-15-28)19(2)29)26-17-21-10-7-11-22(16-21)23(30)31-18-20-8-5-4-6-9-20;/h4-11,16H,3,12-15,17-18H2,1-2H3,(H,25,26);1H |
| InChIKey | WRLZMVVASOJTKQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|