C18H27N5O3 — CID 111162722
ethyl 4-[N'-[(3-carbamoylphenyl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111162722) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is ethyl 4-[N'-[(3-carbamoylphenyl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-[(3-carbamoylphenyl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111162722 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | ethyl 4-[N'-[(3-carbamoylphenyl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H27N5O3/c1-3-20-17(21-13-14-6-5-7-15(12-14)16(19)24)22-8-10-23(11-9-22)18(25)26-4-2/h5-7,12H,3-4,8-11,13H2,1-2H3,(H2,19,24)(H,20,21) |
| InChIKey | XIMKYFAEFZIGQU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|