C22H26F3N5O — CID 111234077
3-[[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]methyl]benzamide (PubChem CID 111234077) has the molecular formula C22H26F3N5O and a molecular weight of 433.48 g/mol. Its IUPAC name is 3-[[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111234077 |
| Molecular Formula | C22H26F3N5O |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-[[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H26F3N5O/c1-2-27-21(28-15-16-5-3-6-17(13-16)20(26)31)30-11-9-29(10-12-30)19-8-4-7-18(14-19)22(23,24)25/h3-8,13-14H,2,9-12,15H2,1H3,(H2,26,31)(H,27,28) |
| InChIKey | KQTSSRUQHCZVJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|