C22H28ClN5O — CID 111186499
3-[[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111186499) has the molecular formula C22H28ClN5O and a molecular weight of 413.95 g/mol. Its IUPAC name is 3-[[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111186499 |
| Molecular Formula | C22H28ClN5O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[[[[4-(3-chlorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H28ClN5O/c1-3-25-22(26-16-17-6-4-7-18(14-17)21(29)24-2)28-12-10-27(11-13-28)20-9-5-8-19(23)15-20/h4-9,14-15H,3,10-13,16H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | HQQHOQZYIFYBAL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|