C24H31IN4O — CID 109414372
3-[[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 109414372) has the molecular formula C24H31IN4O and a molecular weight of 518.44 g/mol. Its IUPAC name is 3-[[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 109414372 |
| Molecular Formula | C24H31IN4O |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 3-[[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)N1CCC(=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C24H30N4O.HI/c1-3-26-24(27-18-21-10-7-11-22(17-21)23(29)25-2)28-14-12-20(13-15-28)16-19-8-5-4-6-9-19;/h4-11,16-17H,3,12-15,18H2,1-2H3,(H,25,29)(H,26,27);1H |
| InChIKey | WQPITSLRZZDVDB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|