C22H35IN4O — CID 109415279
3-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 109415279) has the molecular formula C22H35IN4O and a molecular weight of 498.45 g/mol. Its IUPAC name is 3-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109415279 |
| Molecular Formula | C22H35IN4O |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)N1CCC(=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H34N4O.HI/c1-4-23-22(24-15-12-21(27)25(5-2)6-3)26-16-13-20(14-17-26)18-19-10-8-7-9-11-19;/h7-11,18H,4-6,12-17H2,1-3H3,(H,23,24);1H |
| InChIKey | ZFWOBYKXSSFXMZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|