C20H32FN5O — CID 111148661
N,N-diethyl-3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propanamide (PubChem CID 111148661) has the molecular formula C20H32FN5O and a molecular weight of 377.51 g/mol. Its IUPAC name is N,N-diethyl-3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propanamide.
| Compound Name | N,N-diethyl-3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111148661 |
| Molecular Formula | C20H32FN5O |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | N,N-diethyl-3-[[ethylamino-[4-(2-fluorophenyl)piperazin-1-yl]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H32FN5O/c1-4-22-20(23-12-11-19(27)24(5-2)6-3)26-15-13-25(14-16-26)18-10-8-7-9-17(18)21/h7-10H,4-6,11-16H2,1-3H3,(H,22,23) |
| InChIKey | KIUNQTPOBHBUGB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|