C21H34FN5O — CID 111148369
N-ethyl-4-(2-fluorophenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide (PubChem CID 111148369) has the molecular formula C21H34FN5O and a molecular weight of 391.54 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148369 |
| Molecular Formula | C21H34FN5O |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCOCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H34FN5O/c1-2-23-21(24-9-5-6-10-25-15-17-28-18-16-25)27-13-11-26(12-14-27)20-8-4-3-7-19(20)22/h3-4,7-8H,2,5-6,9-18H2,1H3,(H,23,24) |
| InChIKey | NSPYUTPFGUMTQY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|