C23H40N6O — CID 111186292
N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111186292) has the molecular formula C23H40N6O and a molecular weight of 416.61 g/mol. Its IUPAC name is N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186292 |
| Molecular Formula | C23H40N6O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | N-ethyl-N'-[4-(4-ethylpiperazin-1-yl)butyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCN(CC)CC1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H40N6O/c1-3-24-23(25-11-7-8-12-27-15-13-26(4-2)14-16-27)29-19-17-28(18-20-29)21-9-5-6-10-22(21)30/h5-6,9-10,30H,3-4,7-8,11-20H2,1-2H3,(H,24,25) |
| InChIKey | SOHSYGVSZNDWEW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|