C17H30IN5O3S — CID 111185533
N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(methanesulfonamido)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111185533) has the molecular formula C17H30IN5O3S and a molecular weight of 511.43 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(methanesulfonamido)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(methanesulfonamido)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111185533 |
| Molecular Formula | C17H30IN5O3S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(methanesulfonamido)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCNS(C)(=O)=O)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C17H29N5O3S.HI/c1-3-18-17(19-9-6-10-20-26(2,24)25)22-13-11-21(12-14-22)15-7-4-5-8-16(15)23;/h4-5,7-8,20,23H,3,6,9-14H2,1-2H3,(H,18,19);1H |
| InChIKey | OTBDUEULODQDAI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|