C18H32IN5O — CID 111185271
N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111185271) has the molecular formula C18H32IN5O and a molecular weight of 461.39 g/mol. Its IUPAC name is N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111185271 |
| Molecular Formula | C18H32IN5O |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CC)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C18H31N5O.HI/c1-4-19-18(20-10-11-21(3)5-2)23-14-12-22(13-15-23)16-8-6-7-9-17(16)24;/h6-9,24H,4-5,10-15H2,1-3H3,(H,19,20);1H |
| InChIKey | ZKPZVCHBSIAYPL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|