C17H26N4O — CID 111184808
N'-(cyclopropylmethyl)-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111184808) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N'-(cyclopropylmethyl)-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-(cyclopropylmethyl)-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184808 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N'-(cyclopropylmethyl)-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CC1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-2-18-17(19-13-14-7-8-14)21-11-9-20(10-12-21)15-5-3-4-6-16(15)22/h3-6,14,22H,2,7-13H2,1H3,(H,18,19) |
| InChIKey | ICFLWQFNBNDOAU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|