C21H35N5O — CID 111186028
N-ethyl-4-(2-hydroxyphenyl)-N'-[2-(4-methylpiperidin-1-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111186028) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxyphenyl)-N'-[2-(4-methylpiperidin-1-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[2-(4-methylpiperidin-1-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186028 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[2-(4-methylpiperidin-1-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCC(C)CC1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C21H35N5O/c1-3-22-21(23-10-13-24-11-8-18(2)9-12-24)26-16-14-25(15-17-26)19-6-4-5-7-20(19)27/h4-7,18,27H,3,8-17H2,1-2H3,(H,22,23) |
| InChIKey | PIIMVJNXKLETLA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|