C19H30F3N5O — CID 111184370
N-ethyl-4-(2-hydroxyphenyl)-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide (PubChem CID 111184370) has the molecular formula C19H30F3N5O and a molecular weight of 401.48 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxyphenyl)-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184370 |
| Molecular Formula | C19H30F3N5O |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C19H30F3N5O/c1-3-23-18(24-9-6-10-25(2)15-19(20,21)22)27-13-11-26(12-14-27)16-7-4-5-8-17(16)28/h4-5,7-8,28H,3,6,9-15H2,1-2H3,(H,23,24) |
| InChIKey | CDMFVTMIHCFOLF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|