C19H34IN5O — CID 111133312
N'-[3-(dimethylamino)propyl]-N-ethyl-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111133312) has the molecular formula C19H34IN5O and a molecular weight of 475.42 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N-ethyl-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(dimethylamino)propyl]-N-ethyl-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111133312 |
| Molecular Formula | C19H34IN5O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N-ethyl-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)C)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C19H33N5O.HI/c1-5-20-19(21-11-8-12-22(2)3)24-15-13-23(14-16-24)17-9-6-7-10-18(17)25-4;/h6-7,9-10H,5,8,11-16H2,1-4H3,(H,20,21);1H |
| InChIKey | XVFZXXGIQIJQAE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|