C17H24N4O — CID 75420816
N-ethyl-4-(2-methoxyphenyl)-N'-prop-2-ynylpiperazine-1-carboximidamide (PubChem CID 75420816) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-N'-prop-2-ynylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-N'-prop-2-ynylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 75420816 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-N'-prop-2-ynylpiperazine-1-carboximidamide |
| SMILES | C#CC/N=C(\NCC)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-4-10-19-17(18-5-2)21-13-11-20(12-14-21)15-8-6-7-9-16(15)22-3/h1,6-9H,5,10-14H2,2-3H3,(H,18,19) |
| InChIKey | GBWHXMBUFLZUMU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|