C15H25N5O — CID 116512996
N-amino-4-(2-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide (PubChem CID 116512996) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is N-amino-4-(2-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide.
| Compound Name | N-amino-4-(2-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 116512996 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N-amino-4-(2-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide |
| SMILES | CCC/N=C(\NN)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C15H25N5O/c1-3-8-17-15(18-16)20-11-9-19(10-12-20)13-6-4-5-7-14(13)21-2/h4-7H,3,8-12,16H2,1-2H3,(H,17,18) |
| InChIKey | UHEBUBJLLQJPOI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|