C22H36IN7O — CID 111510529
N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111510529) has the molecular formula C22H36IN7O and a molecular weight of 541.48 g/mol. Its IUPAC name is N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111510529 |
| Molecular Formula | C22H36IN7O |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCC/N=C(\NCCn1cnnc1CC)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C22H35N7O.HI/c1-4-6-11-23-22(24-12-13-29-18-25-26-21(29)5-2)28-16-14-27(15-17-28)19-9-7-8-10-20(19)30-3;/h7-10,18H,4-6,11-17H2,1-3H3,(H,23,24);1H |
| InChIKey | MPFVSIPATDGIHT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|