C23H37N7O2 — CID 111514468
N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111514468) has the molecular formula C23H37N7O2 and a molecular weight of 443.60 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111514468 |
| Molecular Formula | C23H37N7O2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C23H37N7O2/c1-4-22-27-26-19-30(22)12-11-25-23(24-10-7-17-32-5-2)29-15-13-28(14-16-29)20-8-6-9-21(18-20)31-3/h6,8-9,18-19H,4-5,7,10-17H2,1-3H3,(H,24,25) |
| InChIKey | AQRVLIYEZWVQPB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|