C22H34ClN7O — CID 111511835
4-(3-chlorophenyl)-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111511835) has the molecular formula C22H34ClN7O and a molecular weight of 448.02 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111511835 |
| Molecular Formula | C22H34ClN7O |
| Molecular Weight | 448.02 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H34ClN7O/c1-3-21-27-26-18-30(21)11-10-25-22(24-9-6-16-31-4-2)29-14-12-28(13-15-29)20-8-5-7-19(23)17-20/h5,7-8,17-18H,3-4,6,9-16H2,1-2H3,(H,24,25) |
| InChIKey | MKOPEPPUYGBFQY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.02 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|