C23H36N8O — CID 111493518
4-acetyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[3-(N-methylanilino)propyl]piperazine-1-carboximidamide (PubChem CID 111493518) has the molecular formula C23H36N8O and a molecular weight of 440.60 g/mol. Its IUPAC name is 4-acetyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[3-(N-methylanilino)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[3-(N-methylanilino)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493518 |
| Molecular Formula | C23H36N8O |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 4-acetyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[3-(N-methylanilino)propyl]piperazine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\CCCN(C)c1ccccc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C23H36N8O/c1-4-22-27-26-19-31(22)14-12-25-23(30-17-15-29(16-18-30)20(2)32)24-11-8-13-28(3)21-9-6-5-7-10-21/h5-7,9-10,19H,4,8,11-18H2,1-3H3,(H,24,25) |
| InChIKey | MIKJPBCXTFGEQW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|