C19H31FIN7 — CID 111700066
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(3-fluoro-N-methylanilino)propyl]guanidine;hydroiodide (PubChem CID 111700066) has the molecular formula C19H31FIN7 and a molecular weight of 503.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(3-fluoro-N-methylanilino)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(3-fluoro-N-methylanilino)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111700066 |
| Molecular Formula | C19H31FIN7 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(3-fluoro-N-methylanilino)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)c1cccc(F)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C19H30FN7.HI/c1-4-18-25-24-15-27(18)13-11-23-19(21-5-2)22-10-7-12-26(3)17-9-6-8-16(20)14-17;/h6,8-9,14-15H,4-5,7,10-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | OVRNYPVYTYUXBD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|