C19H30FIN6 — CID 111514285
2-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111514285) has the molecular formula C19H30FIN6 and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111514285 |
| Molecular Formula | C19H30FIN6 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCCC/N=C(\NCCn1cnnc1CC)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C19H29FN6.HI/c1-4-6-10-21-19(22-11-12-26-15-23-24-18(26)5-2)25(3)14-16-8-7-9-17(20)13-16;/h7-9,13,15H,4-6,10-12,14H2,1-3H3,(H,21,22);1H |
| InChIKey | JCCGGJQXURKZAA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|