C17H24Cl2N6 — CID 111514980
1-[(3,4-dichlorophenyl)methyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine (PubChem CID 111514980) has the molecular formula C17H24Cl2N6 and a molecular weight of 383.33 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111514980 |
| Molecular Formula | C17H24Cl2N6 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H24Cl2N6/c1-4-16-23-22-12-25(16)9-8-21-17(20-5-2)24(3)11-13-6-7-14(18)15(19)10-13/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,20,21) |
| InChIKey | BANIKOMXUJMABD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|