C18H28N6 — CID 111514222
1-[(4-ethylphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111514222) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-ethylphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111514222 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | CCc1ccc(CN(C)/C(=N/C)NCCn2cnnc2CC)cc1 |
| InChI | InChI=1S/C18H28N6/c1-5-15-7-9-16(10-8-15)13-23(4)18(19-3)20-11-12-24-14-21-22-17(24)6-2/h7-10,14H,5-6,11-13H2,1-4H3,(H,19,20) |
| InChIKey | VVZKHIZAQSAAHN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|