C21H29IN6S2 — CID 111514789
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111514789) has the molecular formula C21H29IN6S2 and a molecular weight of 556.54 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514789 |
| Molecular Formula | C21H29IN6S2 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C21H28N6S2.HI/c1-4-20-25-24-16-27(20)12-11-22-21(23-14-19-6-5-13-29-19)26(2)15-17-7-9-18(28-3)10-8-17;/h5-10,13,16H,4,11-12,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | IIHLQPLIYLOHME-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|