C21H28N6OS — CID 111513992
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(2-phenoxyethyl)-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111513992) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(2-phenoxyethyl)-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(2-phenoxyethyl)-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111513992 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(2-phenoxyethyl)-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C21H28N6OS/c1-3-20-25-24-17-27(20)12-11-22-21(23-16-19-10-7-15-29-19)26(2)13-14-28-18-8-5-4-6-9-18/h4-10,15,17H,3,11-14,16H2,1-2H3,(H,22,23) |
| InChIKey | NKWPRLKKJPUVKB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|