C18H23ClN6S2 — CID 111517159
1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111517159) has the molecular formula C18H23ClN6S2 and a molecular weight of 423.01 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111517159 |
| Molecular Formula | C18H23ClN6S2 |
| Molecular Weight | 423.01 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N/Cc1cccs1)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H23ClN6S2/c1-3-17-23-22-13-25(17)9-8-20-18(21-11-14-5-4-10-26-14)24(2)12-15-6-7-16(19)27-15/h4-7,10,13H,3,8-9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | FDQGYRCYKGNSES-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|