C20H25ClN6S — CID 111515458
1-[1-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111515458) has the molecular formula C20H25ClN6S and a molecular weight of 416.98 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111515458 |
| Molecular Formula | C20H25ClN6S |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)NC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H25ClN6S/c1-3-19-26-24-14-27(19)10-9-22-20(23-13-18-8-5-11-28-18)25-15(2)16-6-4-7-17(21)12-16/h4-8,11-12,14-15H,3,9-10,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | XRPJRXBORLKRKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|