C20H30N8S — CID 111514168
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111514168) has the molecular formula C20H30N8S and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111514168 |
| Molecular Formula | C20H30N8S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C20H30N8S/c1-4-19-25-24-15-27(19)11-9-22-20(23-14-18-7-5-12-29-18)21-8-6-10-28-17(3)13-16(2)26-28/h5,7,12-13,15H,4,6,8-11,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | ZJGABUFSUVDSSY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|