C19H30N6OS — CID 111861396
2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111861396) has the molecular formula C19H30N6OS and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111861396 |
| Molecular Formula | C19H30N6OS |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | Cc1cc(C)n(CCCN/C(=N/CC(=O)N(C)C)NCCc2cccs2)n1 |
| InChI | InChI=1S/C19H30N6OS/c1-15-13-16(2)25(23-15)11-6-9-20-19(22-14-18(26)24(3)4)21-10-8-17-7-5-12-27-17/h5,7,12-13H,6,8-11,14H2,1-4H3,(H2,20,21,22) |
| InChIKey | OKCZUURTCOVLMU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|