C21H33N7O — CID 111280527
2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 111280527) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 111280527 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2-[[[3-(3,5-dimethylpyrazol-1-yl)propylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CCc1ccccn1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C21H33N7O/c1-5-22-21(24-12-8-13-28-18(3)15-17(2)26-28)25-16-20(29)27(4)14-10-19-9-6-7-11-23-19/h6-7,9,11,15H,5,8,10,12-14,16H2,1-4H3,(H2,22,24,25) |
| InChIKey | DYCZIXDXBOLFAN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|