C16H24F3N5O — CID 109471279
2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 109471279) has the molecular formula C16H24F3N5O and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 109471279 |
| Molecular Formula | C16H24F3N5O |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CCc1ccccn1)NCCC(F)(F)F |
| InChI | InChI=1S/C16H24F3N5O/c1-3-20-15(22-10-8-16(17,18)19)23-12-14(25)24(2)11-7-13-6-4-5-9-21-13/h4-6,9H,3,7-8,10-12H2,1-2H3,(H2,20,22,23) |
| InChIKey | XNSSUBXEKQQUMG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|