C19H26F3IN6OS — CID 111689117
2-[[ethylamino-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylamino]methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;hydroiodide (PubChem CID 111689117) has the molecular formula C19H26F3IN6OS and a molecular weight of 570.42 g/mol. Its IUPAC name is 2-[[ethylamino-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylamino]methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylamino]methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111689117 |
| Molecular Formula | C19H26F3IN6OS |
| Molecular Weight | 570.42 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 2-[[ethylamino-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylamino]methylidene]amino]-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CCc1ccccn1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C19H25F3N6OS.HI/c1-3-23-18(25-10-7-16-27-15(13-30-16)19(20,21)22)26-12-17(29)28(2)11-8-14-6-4-5-9-24-14;/h4-6,9,13H,3,7-8,10-12H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | CIYTUUVSKYQJLC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|