C12H17F6IN4S — CID 111989348
1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111989348) has the molecular formula C12H17F6IN4S and a molecular weight of 490.26 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989348 |
| Molecular Formula | C12H17F6IN4S |
| Molecular Weight | 490.26 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C12H16F6N4S.HI/c1-2-19-10(21-6-4-11(13,14)15)20-5-3-9-22-8(7-23-9)12(16,17)18;/h7H,2-6H2,1H3,(H2,19,20,21);1H |
| InChIKey | DIZISVLMBAZFBB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|