C14H23F3IN5OS — CID 111689365
3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111689365) has the molecular formula C14H23F3IN5OS and a molecular weight of 493.34 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111689365 |
| Molecular Formula | C14H23F3IN5OS |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCC(=O)N(C)C.I |
| InChI | InChI=1S/C14H22F3N5OS.HI/c1-4-18-13(20-8-6-12(23)22(2)3)19-7-5-11-21-10(9-24-11)14(15,16)17;/h9H,4-8H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | MNODUCNPTIGIQJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|