C18H30F3N5O2S — CID 111688120
tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111688120) has the molecular formula C18H30F3N5O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111688120 |
| Molecular Formula | C18H30F3N5O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCN(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30F3N5O2S/c1-6-22-15(23-9-8-14-25-13(12-29-14)18(19,20)21)24-10-11-26(7-2)16(27)28-17(3,4)5/h12H,6-11H2,1-5H3,(H2,22,23,24) |
| InChIKey | RNSDDJLVWMCDBH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|