C15H25F3IN5O2S — CID 111617380
tert-butyl N-methyl-N-[2-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111617380) has the molecular formula C15H25F3IN5O2S and a molecular weight of 523.36 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111617380 |
| Molecular Formula | C15H25F3IN5O2S |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C)C(=O)OC(C)(C)C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H24F3N5O2S.HI/c1-14(2,3)25-13(24)23(5)7-6-20-12(19-4)21-8-11-22-10(9-26-11)15(16,17)18;/h9H,6-8H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | WHKZSMGFHKWVDH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|