C14H24F3N5OS — CID 111616862
1-[3-[2-methoxyethyl(methyl)amino]propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616862) has the molecular formula C14H24F3N5OS and a molecular weight of 367.44 g/mol. Its IUPAC name is 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616862 |
| Molecular Formula | C14H24F3N5OS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CCOC)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C14H24F3N5OS/c1-18-13(19-5-4-6-22(2)7-8-23-3)20-9-12-21-11(10-24-12)14(15,16)17/h10H,4-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | PCUJYVFNQVRHAD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|