C16H20F3N5O2S — CID 111616368
1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616368) has the molecular formula C16H20F3N5O2S and a molecular weight of 403.43 g/mol. Its IUPAC name is 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616368 |
| Molecular Formula | C16H20F3N5O2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OCCOC)nc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H20F3N5O2S/c1-20-15(23-9-14-24-12(10-27-14)16(17,18)19)22-8-11-3-4-13(21-7-11)26-6-5-25-2/h3-4,7,10H,5-6,8-9H2,1-2H3,(H2,20,22,23) |
| InChIKey | QFOMFFGOBTXCLH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|