C15H16BrF3N4OS — CID 111616990
1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616990) has the molecular formula C15H16BrF3N4OS and a molecular weight of 437.29 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616990 |
| Molecular Formula | C15H16BrF3N4OS |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OC)c(Br)c1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C15H16BrF3N4OS/c1-20-14(21-6-9-3-4-11(24-2)10(16)5-9)22-7-13-23-12(8-25-13)15(17,18)19/h3-5,8H,6-7H2,1-2H3,(H2,20,21,22) |
| InChIKey | OOMYBSQNSGCLJN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|