C16H20F3IN4O3S — CID 111792494
2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111792494) has the molecular formula C16H20F3IN4O3S and a molecular weight of 532.33 g/mol. Its IUPAC name is 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792494 |
| Molecular Formula | C16H20F3IN4O3S |
| Molecular Weight | 532.33 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 2-methyl-1-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C16H19F3N4O3S.HI/c1-20-15(21-7-13-23-12(8-27-13)16(17,18)19)22-9-5-10(24-2)14(26-4)11(6-9)25-3;/h5-6,8H,7H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | WNEDFMRGKWLYMD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|