C17H20F5IN4O2S — CID 111616554
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616554) has the molecular formula C17H20F5IN4O2S and a molecular weight of 566.33 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616554 |
| Molecular Formula | C17H20F5IN4O2S |
| Molecular Weight | 566.33 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC(F)F)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H19F5N4O2S.HI/c1-23-16(25-8-14-26-13(9-29-14)17(20,21)22)24-6-5-10-3-4-11(27-2)12(7-10)28-15(18)19;/h3-4,7,9,15H,5-6,8H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | KWVCZOOBNSNCRT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|