C18H24F2IN3O2S — CID 111892866
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111892866) has the molecular formula C18H24F2IN3O2S and a molecular weight of 511.38 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111892866 |
| Molecular Formula | C18H24F2IN3O2S |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC(F)F)c1)NCc1sccc1C.I |
| InChI | InChI=1S/C18H23F2N3O2S.HI/c1-12-7-9-26-16(12)11-23-18(21-2)22-8-6-13-4-5-14(24-3)15(10-13)25-17(19)20;/h4-5,7,9-10,17H,6,8,11H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | WNFZDDZYGHQEGU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|