C20H25F2N3O3 — CID 111218161
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111218161) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111218161 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC(F)F)c1)NCc1ccccc1OC |
| InChI | InChI=1S/C20H25F2N3O3/c1-23-20(25-13-15-6-4-5-7-16(15)26-2)24-11-10-14-8-9-17(27-3)18(12-14)28-19(21)22/h4-9,12,19H,10-11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | DELADWIZVHGPIG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|