C19H22F2N6O2 — CID 111015535
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015535) has the molecular formula C19H22F2N6O2 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015535 |
| Molecular Formula | C19H22F2N6O2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC(F)F)c1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H22F2N6O2/c1-22-19(24-12-17-26-25-16-5-3-4-10-27(16)17)23-9-8-13-6-7-14(28-2)15(11-13)29-18(20)21/h3-7,10-11,18H,8-9,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | MNWKTTJGKXUOQD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|