C18H21IN6O2 — CID 111015904
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015904) has the molecular formula C18H21IN6O2 and a molecular weight of 480.31 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015904 |
| Molecular Formula | C18H21IN6O2 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc2c(c1)OCO2)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H20N6O2.HI/c1-19-18(21-11-17-23-22-16-4-2-3-9-24(16)17)20-8-7-13-5-6-14-15(10-13)26-12-25-14;/h2-6,9-10H,7-8,11-12H2,1H3,(H2,19,20,21);1H |
| InChIKey | BEXMZKUIQOHSNF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|